Products 73341-70-5
CAS 73341-70-5 is the registry number for Gunacin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3,6-dihydroxy-8-methoxy-2-methyl-5,10-dioxo-3,4-dihydro-2H-benzo[g]chromen-4-yl) acetate (CAS 73341-70-5) is a chemical compound with the molecular formula C17H16O8 and a molecular weight of 348.3 g/mol. IUPAC name: (3,6-dihydroxy-8-methoxy-2-methyl-5,10-dioxo-3,4-dihydro-2H-benzo[g]chromen-4-yl) acetate. InChIKey: GEQDLVXKRXTSSY-UHFFFAOYSA-N.
| Molecular formula | C17H16O8 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | (3,6-dihydroxy-8-methoxy-2-methyl-5,10-dioxo-3,4-dihydro-2H-benzo[g]chromen-4-yl) acetate |
| InChIKey | GEQDLVXKRXTSSY-UHFFFAOYSA-N |
| SMILES | CC1C(C(C2=C(O1)C(=O)C3=C(C2=O)C(=CC(=C3)OC)O)OC(=O)C)O |
Computed by PubChem (NCBI)