CAS 1404375-16-1 appears in our catalog under these names: 2-Hydrazinyl-1-methylpyridin-1-ium 4-methylbenzenesulfonate, 95+%, 2-Hydrazino-1-methylpyridinium tosylate, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 100mg, 10g, 1g, 250mg.
4-methylbenzenesulfonate;(1-methylpyridin-1-ium-2-yl)hydrazine (CAS 1404375-16-1) is a chemical compound with the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. IUPAC name: 4-methylbenzenesulfonate;(1-methylpyridin-1-ium-2-yl)hydrazine. InChIKey: BTSNOXLIZKNPEP-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O3S |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;(1-methylpyridin-1-ium-2-yl)hydrazine |
| InChIKey | BTSNOXLIZKNPEP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1NN |
Computed by PubChem (NCBI)