CAS 39996-54-8 is the registry number for 1-aminopyridazin-1-ium 2,4,6-trimethylbenzene-1-sulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
Pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (CAS 39996-54-8) is a chemical compound with the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. IUPAC name: pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate. InChIKey: QMJRRGHNNTWMRD-UHFFFAOYSA-M.
| Molecular formula | C13H17N3O3S |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| InChIKey | QMJRRGHNNTWMRD-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)[O-])C.C1=CC=[N+](N=C1)N |
Computed by PubChem (NCBI)