Products 1404692-29-0

CAS 1404692-29-0 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}oxane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid (CAS 1404692-29-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid. InChIKey: YCFDIRVIYFHIIA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO5
Molecular weight245.27 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid
InChIKeyYCFDIRVIYFHIIA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1(CCCOC1)C(=O)O

Computed by PubChem (NCBI)