CAS 1405128-25-7 is the registry number for rel-tert-Butyl ((3R,5R)-5-methylpiperidin-3-yl)carbamate, 98+%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate (CAS 1405128-25-7) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-IUCAKERBSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)