CAS 140621-41-6 appears in our catalog under these names: 2–((1,1'–biphenyl)–4–yl)propan–2–amine hydrochloride, 2-([1,1'-Biphenyl]-4-yl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(4-phenylphenyl)propan-2-amine (CAS 140621-41-6) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 2-(4-phenylphenyl)propan-2-amine. InChIKey: CKJGGRVGNROOBA-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 2-(4-phenylphenyl)propan-2-amine |
| InChIKey | CKJGGRVGNROOBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)