CAS 140646-53-3 appears in our catalog under these names: 4,5-Dimethylthiophene-2-sulfonamide, 97%, 4,5-Dimethylthiophene-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5-dimethylthiophene-2-sulfonamide (CAS 140646-53-3) is a chemical compound with the molecular formula C6H9NO2S2 and a molecular weight of 191.3 g/mol. IUPAC name: 4,5-dimethylthiophene-2-sulfonamide. InChIKey: RFXSVPDXWQGDIS-UHFFFAOYSA-N.
| Molecular formula | C6H9NO2S2 |
|---|---|
| Molecular weight | 191.3 g/mol |
| IUPAC name | 4,5-dimethylthiophene-2-sulfonamide |
| InChIKey | RFXSVPDXWQGDIS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)S(=O)(=O)N)C |
Computed by PubChem (NCBI)