Products 85109-45-1

CAS 85109-45-1 is the registry number for 3-(Isothiocyanatomethyl)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(isothiocyanatomethyl)thiolane 1,1-dioxide (CAS 85109-45-1) is a chemical compound with the molecular formula C6H9NO2S2 and a molecular weight of 191.3 g/mol. IUPAC name: 3-(isothiocyanatomethyl)thiolane 1,1-dioxide. InChIKey: FABOUSHMFZLIPM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9NO2S2
Molecular weight191.3 g/mol
IUPAC name3-(isothiocyanatomethyl)thiolane 1,1-dioxide
InChIKeyFABOUSHMFZLIPM-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1CN=C=S

Computed by PubChem (NCBI)