CAS 140647-19-4 is the registry number for 3,5-Bis(trifluoromethyl)-1-phenylpyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-phenyl-3,5-bis(trifluoromethyl)pyrazole (CAS 140647-19-4) is a chemical compound with the molecular formula C11H6F6N2 and a molecular weight of 280.17 g/mol. IUPAC name: 1-phenyl-3,5-bis(trifluoromethyl)pyrazole. InChIKey: IYNLHYNHSRWJHI-UHFFFAOYSA-N.
| Molecular formula | C11H6F6N2 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 1-phenyl-3,5-bis(trifluoromethyl)pyrazole |
| InChIKey | IYNLHYNHSRWJHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)