Products 154258-54-5
CAS 154258-54-5 is the registry number for 3-[3,5-Bis(trifluoromethyl)phenyl]-1H-pyrazole, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole (CAS 154258-54-5) is a chemical compound with the molecular formula C11H6F6N2 and a molecular weight of 280.17 g/mol. IUPAC name: 5-[3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole. InChIKey: HRBJMDVPHVEWNY-UHFFFAOYSA-N.
| Molecular formula | C11H6F6N2 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 5-[3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole |
| InChIKey | HRBJMDVPHVEWNY-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)