CAS 1406566-96-8 appears in our catalog under these names: 3-(tert-Butyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline, 95%, 3-(tert-Butyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-tert-butyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1406566-96-8) is a chemical compound with the molecular formula C14H18F3N and a molecular weight of 257.29 g/mol. IUPAC name: 3-tert-butyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: OEJJAFIVOUUAHZ-UHFFFAOYSA-N.
| Molecular formula | C14H18F3N |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 3-tert-butyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | OEJJAFIVOUUAHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC2=C(C=CC(=C2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)