CAS 944348-11-2 is the registry number for 1-(4-Trifluoromethylphenyl)cyclohexanemethanamine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[1-[4-(trifluoromethyl)phenyl]cyclohexyl]methanamine (CAS 944348-11-2) is a chemical compound with the molecular formula C14H18F3N and a molecular weight of 257.29 g/mol. IUPAC name: [1-[4-(trifluoromethyl)phenyl]cyclohexyl]methanamine. InChIKey: PGGTUNCWXAFOIJ-UHFFFAOYSA-N.
| Molecular formula | C14H18F3N |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | [1-[4-(trifluoromethyl)phenyl]cyclohexyl]methanamine |
| InChIKey | PGGTUNCWXAFOIJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CN)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)