Products 14075-54-8
CAS 14075-54-8 is the registry number for (R)-Quinolin-4-yl((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate (CAS 14075-54-8) is a chemical compound with the molecular formula C21H24N2O2 and a molecular weight of 336.4 g/mol. IUPAC name: [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate. InChIKey: NDBICTMGDYGBFE-SNHGZMDHSA-N.
| Molecular formula | C21H24N2O2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate |
| InChIKey | NDBICTMGDYGBFE-SNHGZMDHSA-N |
| SMILES | CC(=O)O[C@@H]([C@@H]1C[C@@H]2CCN1C[C@@H]2C=C)C3=CC=NC4=CC=CC=C34 |
Computed by PubChem (NCBI)