CAS 14461-05-3 is the registry number for (S)-Quinolin-4-yl((1S,2R,4S,5R)-5-vinylquinuclidin-2-yl)methyl acetate, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate (CAS 14461-05-3) is a chemical compound with the molecular formula C21H24N2O2 and a molecular weight of 336.4 g/mol. IUPAC name: [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate. InChIKey: NDBICTMGDYGBFE-AFMUBRCDSA-N.
| Molecular formula | C21H24N2O2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate |
| InChIKey | NDBICTMGDYGBFE-AFMUBRCDSA-N |
| SMILES | CC(=O)O[C@H]([C@H]1C[C@@H]2CCN1C[C@@H]2C=C)C3=CC=NC4=CC=CC=C34 |
Computed by PubChem (NCBI)