CAS 14080-32-1 is the registry number for 5-Nitropyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-nitropyrimidine (CAS 14080-32-1) is a chemical compound with the molecular formula C4H3N3O2 and a molecular weight of 125.09 g/mol. IUPAC name: 5-nitropyrimidine. InChIKey: NOYDQGFVFOQSAJ-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O2 |
|---|---|
| Molecular weight | 125.09 g/mol |
| IUPAC name | 5-nitropyrimidine |
| InChIKey | NOYDQGFVFOQSAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)