Products 859766-68-0

CAS 859766-68-0 is the registry number for 1,2,4-Triazine-6-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,2,4-triazine-6-carboxylic acid (CAS 859766-68-0) is a chemical compound with the molecular formula C4H3N3O2 and a molecular weight of 125.09 g/mol. IUPAC name: 1,2,4-triazine-6-carboxylic acid. InChIKey: YWFARCBGCLDLFI-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3N3O2
Molecular weight125.09 g/mol
IUPAC name1,2,4-triazine-6-carboxylic acid
InChIKeyYWFARCBGCLDLFI-UHFFFAOYSA-N
SMILESC1=C(N=NC=N1)C(=O)O

Computed by PubChem (NCBI)