CAS 1408072-62-7 is the registry number for Epalrestat Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,4E)-2,4-dimethyl-5-phenylpenta-2,4-dienal (CAS 1408072-62-7) is a chemical compound with the molecular formula C13H14O and a molecular weight of 186.25 g/mol. IUPAC name: (2E,4E)-2,4-dimethyl-5-phenylpenta-2,4-dienal. InChIKey: QRURQFVTACCORQ-FYDMFQIUSA-N.
| Molecular formula | C13H14O |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | (2E,4E)-2,4-dimethyl-5-phenylpenta-2,4-dienal |
| InChIKey | QRURQFVTACCORQ-FYDMFQIUSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/C=C(\C)/C=O |
Computed by PubChem (NCBI)