Products 1408074-80-5

CAS 1408074-80-5 is the registry number for 1-Boc-azepan-4-carboxylic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(hydrazinecarbonyl)azepane-1-carboxylate (CAS 1408074-80-5) is a chemical compound with the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl 4-(hydrazinecarbonyl)azepane-1-carboxylate. InChIKey: QMPOWYLAZSUMOR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23N3O3
Molecular weight257.33 g/mol
IUPAC nametert-butyl 4-(hydrazinecarbonyl)azepane-1-carboxylate
InChIKeyQMPOWYLAZSUMOR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(CC1)C(=O)NN

Computed by PubChem (NCBI)