CAS 2828460-05-3 is the registry number for 1-(4-Bromo-6-chloroisoindolin-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-6-chloro-1,3-dihydroisoindol-2-yl)ethanone (CAS 2828460-05-3) is a chemical compound with the molecular formula C10H9BrClNO and a molecular weight of 274.54 g/mol. IUPAC name: 1-(4-bromo-6-chloro-1,3-dihydroisoindol-2-yl)ethanone. InChIKey: HHOSFDPVCYLJLF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 1-(4-bromo-6-chloro-1,3-dihydroisoindol-2-yl)ethanone |
| InChIKey | HHOSFDPVCYLJLF-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2=C(C1)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)