Products 1408236-74-7
CAS 1408236-74-7 is the registry number for 3-methyl-3-(trifluoromethyl)indan-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-methyl-3-(trifluoromethyl)-2H-inden-1-one (CAS 1408236-74-7) is a chemical compound with the molecular formula C11H9F3O and a molecular weight of 214.18 g/mol. IUPAC name: 3-methyl-3-(trifluoromethyl)-2H-inden-1-one. InChIKey: VUPXNAWNGKJMKO-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 3-methyl-3-(trifluoromethyl)-2H-inden-1-one |
| InChIKey | VUPXNAWNGKJMKO-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=CC=CC=C21)C(F)(F)F |
Computed by PubChem (NCBI)