CAS 1408279-16-2 appears in our catalog under these names: 2-{2-((Trifluoromethyl)sulfanyl)ethyl}-2,3-dihydro-1H-isoindole-1,3-dione, 2-{2-((trifluoromethyl)sulfanyl)ethyl}-2,3-dihydro-1H-isoindole-1,3-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-[2-(trifluoromethylsulfanyl)ethyl]isoindole-1,3-dione (CAS 1408279-16-2) is a chemical compound with the molecular formula C11H8F3NO2S and a molecular weight of 275.25 g/mol. IUPAC name: 2-[2-(trifluoromethylsulfanyl)ethyl]isoindole-1,3-dione. InChIKey: KQMBJIXDYDMSKW-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2S |
|---|---|
| Molecular weight | 275.25 g/mol |
| IUPAC name | 2-[2-(trifluoromethylsulfanyl)ethyl]isoindole-1,3-dione |
| InChIKey | KQMBJIXDYDMSKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCSC(F)(F)F |
Computed by PubChem (NCBI)