CAS 885527-39-9 is the registry number for 3-(5-(Trifluoromethyl)-1,3-benzothiazol-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoic acid (CAS 885527-39-9) is a chemical compound with the molecular formula C11H8F3NO2S and a molecular weight of 275.25 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoic acid. InChIKey: AFEGGPMARRPYGE-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2S |
|---|---|
| Molecular weight | 275.25 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]propanoic acid |
| InChIKey | AFEGGPMARRPYGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(S2)CCC(=O)O |
Computed by PubChem (NCBI)