Products 14087-70-8
CAS 14087-70-8 is the registry number for (1R)-Chrysanthemolactone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, Get quote.
(1R,6S)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one (CAS 14087-70-8) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (1R,6S)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one. InChIKey: XAKBEOUVVTWXNF-BQBZGAKWSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (1R,6S)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one |
| InChIKey | XAKBEOUVVTWXNF-BQBZGAKWSA-N |
| SMILES | CC1(C[C@H]2[C@H](C2(C)C)C(=O)O1)C |
Computed by PubChem (NCBI)