Products 14087-71-9
CAS 14087-71-9 is the registry number for (1S)-Chrysanthemolactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,6R)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one (CAS 14087-71-9) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (1S,6R)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one. InChIKey: XAKBEOUVVTWXNF-RNFRBKRXSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (1S,6R)-4,4,7,7-tetramethyl-3-oxabicyclo[4.1.0]heptan-2-one |
| InChIKey | XAKBEOUVVTWXNF-RNFRBKRXSA-N |
| SMILES | CC1(C[C@@H]2[C@@H](C2(C)C)C(=O)O1)C |
Computed by PubChem (NCBI)