Products 1409216-81-4
CAS 1409216-81-4 is the registry number for 1-N-(1-Methanesulfonylpiperidin-4-yl)-4-methylbenzene-1,3-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methyl-1-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,3-diamine (CAS 1409216-81-4) is a chemical compound with the molecular formula C13H21N3O2S and a molecular weight of 283.39 g/mol. IUPAC name: 4-methyl-1-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,3-diamine. InChIKey: JOBXDARLWBUESV-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O2S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | 4-methyl-1-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,3-diamine |
| InChIKey | JOBXDARLWBUESV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2CCN(CC2)S(=O)(=O)C)N |
Computed by PubChem (NCBI)