Products 849546-65-2

CAS 849546-65-2 is the registry number for tert-Butyl 4-((1,3-thiazol-2-yl)amino)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(1,3-thiazol-2-ylamino)piperidine-1-carboxylate (CAS 849546-65-2) is a chemical compound with the molecular formula C13H21N3O2S and a molecular weight of 283.39 g/mol. IUPAC name: tert-butyl 4-(1,3-thiazol-2-ylamino)piperidine-1-carboxylate. InChIKey: WIYJAVZGTOLQKS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21N3O2S
Molecular weight283.39 g/mol
IUPAC nametert-butyl 4-(1,3-thiazol-2-ylamino)piperidine-1-carboxylate
InChIKeyWIYJAVZGTOLQKS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)NC2=NC=CS2

Computed by PubChem (NCBI)