CAS 1409361-34-7 is the registry number for 3-(2-Chloro-3,4-dimethoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-chloro-3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1409361-34-7) is a chemical compound with the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. IUPAC name: 3-(2-chloro-3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: KRRFGIRYGAFJFF-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO5 |
|---|---|
| Molecular weight | 297.69 g/mol |
| IUPAC name | 3-(2-chloro-3,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | KRRFGIRYGAFJFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C(=C(C=C2)OC)OC)Cl)C(=O)O |
Computed by PubChem (NCBI)