Products 62760-01-4

CAS 62760-01-4 is the registry number for Nimodipine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloroethyl 2-[(2-nitrophenyl)methylidene]-3-oxobutanoate (CAS 62760-01-4) is a chemical compound with the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. IUPAC name: 2-chloroethyl 2-[(2-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: MHSXTMIKGZNWFF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO5
Molecular weight297.69 g/mol
IUPAC name2-chloroethyl 2-[(2-nitrophenyl)methylidene]-3-oxobutanoate
InChIKeyMHSXTMIKGZNWFF-UHFFFAOYSA-N
SMILESCC(=O)C(=CC1=CC=CC=C1[N+](=O)[O-])C(=O)OCCCl

Computed by PubChem (NCBI)