Products 1409513-39-8
CAS 1409513-39-8 is the registry number for 1,1-Dimethylethyl 2-methoxy-5-methylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2-methoxy-5-methylbenzoate (CAS 1409513-39-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl 2-methoxy-5-methylbenzoate. InChIKey: LWFVTJJWUWXLFH-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl 2-methoxy-5-methylbenzoate |
| InChIKey | LWFVTJJWUWXLFH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)