Products 1409734-37-7
CAS 1409734-37-7 is the registry number for 3-(4-Bromophenyl)-5-tert-butyl-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-bromophenyl)-5-tert-butyl-1,2-oxazole-4-carboxylic acid (CAS 1409734-37-7) is a chemical compound with the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. IUPAC name: 3-(4-bromophenyl)-5-tert-butyl-1,2-oxazole-4-carboxylic acid. InChIKey: PPPLNFHGPRLKPE-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-tert-butyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | PPPLNFHGPRLKPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=NO1)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)