Products 141-02-6
CAS 141-02-6 appears in our catalog under these names: Bis(2-ethylhexyl) fumarate, 98%, Bis(2-ethylhexyl) Fumarate, Bis(2-ethylhexyl) Fumarate, >98.0%(GC). Offered by: Combi-blocks, Chemat Brand, TRC, TCI. Available pack sizes: 1kg, 100g, 500g, 25g, 5g, on request, 10ml, 50ml.
Bis(2-ethylhexyl) (E)-but-2-enedioate (CAS 141-02-6) is a chemical compound with the molecular formula C20H36O4 and a molecular weight of 340.5 g/mol. IUPAC name: bis(2-ethylhexyl) (E)-but-2-enedioate. InChIKey: ROPXFXOUUANXRR-BUHFOSPRSA-N.
| Molecular formula | C20H36O4 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | bis(2-ethylhexyl) (E)-but-2-enedioate |
| InChIKey | ROPXFXOUUANXRR-BUHFOSPRSA-N |
| SMILES | CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)
Synonyms:
Bis(2-ethylhexyl) fumarate, Di(2-ethylhexyl) fumarate, 2-Ethylhexyl fumarate, RC Comonomer DOF, DIETHYLHEXYL FUMARATE, 2-Butenedioic acid, bis(2-ethylhexyl) ester, 2-Butenedioic acid (2E)-, bis(2-ethylhexyl) ester, Bis-(2-ethylhexyl)ester kyseliny fumarove [Czech], 2-Butenedioic acid, (E)-, bis(2-ethylhexyl) ester, Bis-(2-ethylhexyl)ester kyseliny fumarove