Products 2997-85-5
CAS 2997-85-5 appears in our catalog under these names: Dioctyl fumarate, 95%, Dioctyl fumarate, 98+%, Dioctyl Fumarate, Dioctyl Fumarate, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
Dioctyl (E)-but-2-enedioate (CAS 2997-85-5) is a chemical compound with the molecular formula C20H36O4 and a molecular weight of 340.5 g/mol. IUPAC name: dioctyl (E)-but-2-enedioate. InChIKey: TVWTZAGVNBPXHU-FOCLMDBBSA-N.
| Molecular formula | C20H36O4 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | dioctyl (E)-but-2-enedioate |
| InChIKey | TVWTZAGVNBPXHU-FOCLMDBBSA-N |
| SMILES | CCCCCCCCOC(=O)/C=C/C(=O)OCCCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
2-Butenedioic acid (2E)-, 1,4-dioctyl ester, 2-Butenedioic acid (2E)-, dioctyl ester, Fumaric acid, dioctyl ester, 1,4-Dioctyl (2E)-2-butenedioate, 2-Butenedioic acid, (E)-, dioctyl ester, dioctyl (E)-but-2-enedioate, Di-n-octyl fumarate, Dioctylfumarate, Dioctyl (2e)-2-butenedioate, dicapryl fumarate