Products 14101-58-7
CAS 14101-58-7 appears in our catalog under these names: N-benzylsulfamide, N-benzylsulfamide 97%, N-Benzylsulfamide, 97%, 97%, N-Benzylaminosulfonamide, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem, MedChemExpress. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
(sulfamoylamino)methylbenzene (CAS 14101-58-7) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: (sulfamoylamino)methylbenzene. InChIKey: SYKLNLIUTCAYCR-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (sulfamoylamino)methylbenzene |
| InChIKey | SYKLNLIUTCAYCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
N-Benzylaminosulfonamide, N-benzylsulfamide, (Sulfamoylamino)Methylbenzene, N-benzylsulfuric diamide, aminobenzylsulfonamide, Sulfamide, N-[5-(4-bromophenyl)-6-chloro-4-pyrimidinyl]-N'-(phenylmethyl)-, Sulfamide, (phenylmethyl)-, benzyl-sulfamide, (Sulfamoyl amino) methyl benzene, N-Benzylsulfamoylamine