CAS 141019-01-4 is the registry number for methyl 4–(4–azidobutyl)benzoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 500mg, 5g.
Methyl 4-(4-azidobutyl)benzoate (CAS 141019-01-4) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: methyl 4-(4-azidobutyl)benzoate. InChIKey: UUVWANUEKBSRCS-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | methyl 4-(4-azidobutyl)benzoate |
| InChIKey | UUVWANUEKBSRCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)