CAS 141071-79-6 appears in our catalog under these names: 3-(1-Benzyl-1H-indol-3-yl)propanoic acid, 95%, 3-(1-Benzyl-1H-indol-3-yl)propanoic acid, 98+%, 98+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-(1-benzylindol-3-yl)propanoic acid (CAS 141071-79-6) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: 3-(1-benzylindol-3-yl)propanoic acid. InChIKey: QTUJYJWSZIVMMF-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 3-(1-benzylindol-3-yl)propanoic acid |
| InChIKey | QTUJYJWSZIVMMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)CCC(=O)O |
Computed by PubChem (NCBI)