CAS 313498-12-3 appears in our catalog under these names: 1-Benzyl-2,3-dimethyl-1h-indole-5-carboxylic acid, 95%, 1-Benzyl-2,3-dimethyl-1H-indole-5-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
1-benzyl-2,3-dimethylindole-5-carboxylic acid (CAS 313498-12-3) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: 1-benzyl-2,3-dimethylindole-5-carboxylic acid. InChIKey: HLVAZMLZZGYECV-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 1-benzyl-2,3-dimethylindole-5-carboxylic acid |
| InChIKey | HLVAZMLZZGYECV-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)C(=O)O)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)