CAS 141081-25-6 is the registry number for (buta-2,3-dien-1-yloxy)(tert-butyl)dimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Buta-2,3-dienoxy-tert-butyl-dimethylsilane (CAS 141081-25-6) is a chemical compound with the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. IUPAC name: buta-2,3-dienoxy-tert-butyl-dimethylsilane. InChIKey: GGESMLNOMIPHKW-UHFFFAOYSA-N.
| Molecular formula | C10H20OSi |
|---|---|
| Molecular weight | 184.35 g/mol |
| IUPAC name | buta-2,3-dienoxy-tert-butyl-dimethylsilane |
| InChIKey | GGESMLNOMIPHKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC=C=C |
Computed by PubChem (NCBI)