CAS 777950-96-6 is the registry number for ((3,3-Dimethylcyclopent-1-en-1-yl)oxy)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,3-dimethylcyclopenten-1-yl)oxy-trimethylsilane (CAS 777950-96-6) is a chemical compound with the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. IUPAC name: (3,3-dimethylcyclopenten-1-yl)oxy-trimethylsilane. InChIKey: LXCCPQVEHFWKCB-UHFFFAOYSA-N.
| Molecular formula | C10H20OSi |
|---|---|
| Molecular weight | 184.35 g/mol |
| IUPAC name | (3,3-dimethylcyclopenten-1-yl)oxy-trimethylsilane |
| InChIKey | LXCCPQVEHFWKCB-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=C1)O[Si](C)(C)C)C |
Computed by PubChem (NCBI)