CAS 88346-87-6 is the registry number for (E)-(Buta-1,3-dien-1-yloxy)(tert-butyl)dimethylsilane, 97% +(stabilized with TBC). Offered by: Chemat Brand. Available pack sizes: on request.
[(1E)-buta-1,3-dienoxy]-tert-butyl-dimethylsilane (CAS 88346-87-6) is a chemical compound with the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. IUPAC name: [(1E)-buta-1,3-dienoxy]-tert-butyl-dimethylsilane. InChIKey: FOVNQHKJPKSUOU-CMDGGOBGSA-N.
| Molecular formula | C10H20OSi |
|---|---|
| Molecular weight | 184.35 g/mol |
| IUPAC name | [(1E)-buta-1,3-dienoxy]-tert-butyl-dimethylsilane |
| InChIKey | FOVNQHKJPKSUOU-CMDGGOBGSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C/C=C |
Computed by PubChem (NCBI)