Products 1410831-12-7
CAS 1410831-12-7 appears in our catalog under these names: Aripiprazole Impurity 24, Milnacipran Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one (CAS 1410831-12-7) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: (1R,5R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one. InChIKey: WZGFIZUMKYUMRN-ONGXEEELSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (1R,5R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
| InChIKey | WZGFIZUMKYUMRN-ONGXEEELSA-N |
| SMILES | C1[C@@H]2[C@@]1(C(=O)OC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)