Products 96847-52-8
CAS 96847-52-8 appears in our catalog under these names: Milnacipran Impurity 10, rac 1-Phenyl-2-oxo-3-oxabicyclo(3.1.0)hexane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
(1R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one (CAS 96847-52-8) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: (1R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one. InChIKey: WZGFIZUMKYUMRN-UMJHXOGRSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (1R)-1-phenyl-3-oxabicyclo[3.1.0]hexan-2-one |
| InChIKey | WZGFIZUMKYUMRN-UMJHXOGRSA-N |
| SMILES | C1C2[C@@]1(C(=O)OC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)