CAS 1410877-36-9 is the registry number for 9-([1,1':3',1''-Terphenyl]-5'-yl)-3-bromo-9H-carbazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-9-(3,5-diphenylphenyl)carbazole (CAS 1410877-36-9) is a chemical compound with the molecular formula C30H20BrN and a molecular weight of 474.4 g/mol. IUPAC name: 3-bromo-9-(3,5-diphenylphenyl)carbazole. InChIKey: SJAUGFZYJBUAAT-UHFFFAOYSA-N.
| Molecular formula | C30H20BrN |
|---|---|
| Molecular weight | 474.4 g/mol |
| IUPAC name | 3-bromo-9-(3,5-diphenylphenyl)carbazole |
| InChIKey | SJAUGFZYJBUAAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)N3C4=C(C=C(C=C4)Br)C5=CC=CC=C53)C6=CC=CC=C6 |
Computed by PubChem (NCBI)