CAS 607739-92-4 is the registry number for 9-(4-Bromophenyl)-3,6-diphenyl-9H-carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(4-bromophenyl)-3,6-diphenylcarbazole (CAS 607739-92-4) is a chemical compound with the molecular formula C30H20BrN and a molecular weight of 474.4 g/mol. IUPAC name: 9-(4-bromophenyl)-3,6-diphenylcarbazole. InChIKey: WOOAKXXQTAVKGL-UHFFFAOYSA-N.
| Molecular formula | C30H20BrN |
|---|---|
| Molecular weight | 474.4 g/mol |
| IUPAC name | 9-(4-bromophenyl)-3,6-diphenylcarbazole |
| InChIKey | WOOAKXXQTAVKGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=C3C=C(C=C4)C5=CC=CC=C5)C6=CC=C(C=C6)Br |
Computed by PubChem (NCBI)