CAS 141091-31-8 is the registry number for (E)-6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile (CAS 141091-31-8) is a chemical compound with the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. IUPAC name: (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile. InChIKey: KHMNZDWKJKKHNU-VQHVLOKHSA-N.
| Molecular formula | C12H20BNO2 |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
| InChIKey | KHMNZDWKJKKHNU-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCC#N |
Computed by PubChem (NCBI)