CAS 1704069-17-9 is the registry number for (4–(1–(Diethylamino)ethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-[1-(diethylamino)ethyl]phenyl]boronic acid (CAS 1704069-17-9) is a chemical compound with the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. IUPAC name: [4-[1-(diethylamino)ethyl]phenyl]boronic acid. InChIKey: ZLQFWDOKGQUZKI-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO2 |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | [4-[1-(diethylamino)ethyl]phenyl]boronic acid |
| InChIKey | ZLQFWDOKGQUZKI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)N(CC)CC)(O)O |
Computed by PubChem (NCBI)