CAS 1411993-04-8 is the registry number for 3'-Methyl-4'-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-biphenyl-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (CAS 1411993-04-8) is a chemical compound with the molecular formula C21H25BO4 and a molecular weight of 352.2 g/mol. IUPAC name: methyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate. InChIKey: PCPUXPYXSCLGBT-UHFFFAOYSA-N.
| Molecular formula | C21H25BO4 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | methyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| InChIKey | PCPUXPYXSCLGBT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3=CC=C(C=C3)C(=O)OC)C |
Computed by PubChem (NCBI)