CAS 2121511-93-9 appears in our catalog under these names: 4-(Benzyloxycarbonyl)-3-methylphenylboronic acid pinacol ester, 95%, 4-(Benzyloxycarbonyl)-3-methylphenylboronic acid pinacol ester, ≥95%, ≥95%, 4-(Benzyloxycarbonyl)-3-methylphenylboronic acid pinacol ester. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Benzyl 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2121511-93-9) is a chemical compound with the molecular formula C21H25BO4 and a molecular weight of 352.2 g/mol. IUPAC name: benzyl 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: LPOHOIYXZRPCAD-UHFFFAOYSA-N.
| Molecular formula | C21H25BO4 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | benzyl 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | LPOHOIYXZRPCAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)