CAS 2445899-37-4 is the registry number for Ethyl 4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1'-biphenyl]-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (CAS 2445899-37-4) is a chemical compound with the molecular formula C21H25BO4 and a molecular weight of 352.2 g/mol. IUPAC name: ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate. InChIKey: IHNLWHWOWJLBLE-UHFFFAOYSA-N.
| Molecular formula | C21H25BO4 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | ethyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| InChIKey | IHNLWHWOWJLBLE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)OCC |
Computed by PubChem (NCBI)