CAS 1412414-09-5 appears in our catalog under these names: Potassium 4-butylphenyltrifluoroborate, 97%, Potassium 4–butylphenyltrifluoroborate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Potassium (4-butylphenyl)-trifluoroboranuide (CAS 1412414-09-5) is a chemical compound with the molecular formula C10H13BF3K and a molecular weight of 240.12 g/mol. IUPAC name: potassium (4-butylphenyl)-trifluoroboranuide. InChIKey: LMRSUMOZYVDMLI-UHFFFAOYSA-N.
| Molecular formula | C10H13BF3K |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | potassium (4-butylphenyl)-trifluoroboranuide |
| InChIKey | LMRSUMOZYVDMLI-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)CCCC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)