CAS 423118-47-2 is the registry number for Potassium (4-(tert-butyl)phenyl)trifluoroborate, 98%. Offered by: Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g.
Potassium (4-tert-butylphenyl)-trifluoroboranuide (CAS 423118-47-2) is a chemical compound with the molecular formula C10H13BF3K and a molecular weight of 240.12 g/mol. IUPAC name: potassium (4-tert-butylphenyl)-trifluoroboranuide. InChIKey: RQPOMNZPBPIWDB-UHFFFAOYSA-N.
| Molecular formula | C10H13BF3K |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | potassium (4-tert-butylphenyl)-trifluoroboranuide |
| InChIKey | RQPOMNZPBPIWDB-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)C(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)